C13H12IN3O4 — CID 168567875
dimethyl (E)-2-[(3-iodo-2H-indazol-7-yl)amino]but-2-enedioate (PubChem CID 168567875) has the molecular formula C13H12IN3O4 and a molecular weight of 401.16 g/mol. Its IUPAC name is dimethyl (E)-2-[(3-iodo-2H-indazol-7-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(3-iodo-2H-indazol-7-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567875 |
| Molecular Formula | C13H12IN3O4 |
| Molecular Weight | 401.16 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | dimethyl (E)-2-[(3-iodo-2H-indazol-7-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c(I)[nH]nc12)C(=O)OC |
| InChI | InChI=1S/C13H12IN3O4/c1-20-10(18)6-9(13(19)21-2)15-8-5-3-4-7-11(8)16-17-12(7)14/h3-6,15H,1-2H3,(H,16,17)/b9-6+ |
| InChIKey | UDBQDORVXVOADQ-RMKNXTFCSA-N |
| XLogP | 1.81 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|