C16H17N3O6 — CID 168567230
dimethyl (E)-2-[(2,3-dimethyl-1,4-dioxophthalazin-5-yl)amino]but-2-enedioate (PubChem CID 168567230) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is dimethyl (E)-2-[(2,3-dimethyl-1,4-dioxophthalazin-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2,3-dimethyl-1,4-dioxophthalazin-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567230 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | dimethyl (E)-2-[(2,3-dimethyl-1,4-dioxophthalazin-5-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c(=O)n(C)n(C)c(=O)c12)C(=O)OC |
| InChI | InChI=1S/C16H17N3O6/c1-18-14(21)9-6-5-7-10(13(9)15(22)19(18)2)17-11(16(23)25-4)8-12(20)24-3/h5-8,17H,1-4H3/b11-8+ |
| InChIKey | UZUMAMZBLUSIBO-DHZHZOJOSA-N |
| XLogP | -0.12 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|