C15H17N3O5 — CID 168567482
dimethyl (E)-2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]but-2-enedioate (PubChem CID 168567482) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is dimethyl (E)-2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567482 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | dimethyl (E)-2-[(1-methyl-2-oxo-3,4-dihydroquinazolin-5-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c1CNC(=O)N2C)C(=O)OC |
| InChI | InChI=1S/C15H17N3O5/c1-18-12-6-4-5-10(9(12)8-16-15(18)21)17-11(14(20)23-3)7-13(19)22-2/h4-7,17H,8H2,1-3H3,(H,16,21)/b11-7+ |
| InChIKey | YHHWMRUFBWIZOA-YRNVUSSQSA-N |
| XLogP | 0.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|