C21H21N3O5 — CID 168567139
dimethyl (E)-2-[[1-oxo-2-(2-pyridin-2-ylethyl)-3H-isoindol-4-yl]amino]but-2-enedioate (PubChem CID 168567139) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is dimethyl (E)-2-[[1-oxo-2-(2-pyridin-2-ylethyl)-3H-isoindol-4-yl]amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[1-oxo-2-(2-pyridin-2-ylethyl)-3H-isoindol-4-yl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567139 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | dimethyl (E)-2-[[1-oxo-2-(2-pyridin-2-ylethyl)-3H-isoindol-4-yl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc2c1CN(CCc1ccccn1)C2=O)C(=O)OC |
| InChI | InChI=1S/C21H21N3O5/c1-28-19(25)12-18(21(27)29-2)23-17-8-5-7-15-16(17)13-24(20(15)26)11-9-14-6-3-4-10-22-14/h3-8,10,12,23H,9,11,13H2,1-2H3/b18-12+ |
| InChIKey | REGOJGVFWNXZDR-LDADJPATSA-N |
| XLogP | 1.92 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|