C21H17ClN2O7 — CID 168570018
dimethyl (E)-2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]but-2-enedioate (PubChem CID 168570018) has the molecular formula C21H17ClN2O7 and a molecular weight of 444.83 g/mol. Its IUPAC name is dimethyl (E)-2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570018 |
| Molecular Formula | C21H17ClN2O7 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | dimethyl (E)-2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(CN2C(=O)c3ccccc3C2=O)cc(Cl)c1O)C(=O)OC |
| InChI | InChI=1S/C21H17ClN2O7/c1-30-17(25)9-16(21(29)31-2)23-15-8-11(7-14(22)18(15)26)10-24-19(27)12-5-3-4-6-13(12)20(24)28/h3-9,23,26H,10H2,1-2H3/b16-9+ |
| InChIKey | KMBDGFMDZPQTEK-CXUHLZMHSA-N |
| XLogP | 2.48 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|