C18H14ClNO4 — CID 12988819
methyl 2-[3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]acetate (PubChem CID 12988819) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 12988819 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | methyl 2-[3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(CN2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClNO4/c1-24-16(21)9-11-6-7-12(15(19)8-11)10-20-17(22)13-4-2-3-5-14(13)18(20)23/h2-8H,9-10H2,1H3 |
| InChIKey | QHHISJKWUHIUIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|