C15H9ClN2O4 — CID 67300541
2-[(3-chloro-4-nitrophenyl)methyl]isoindole-1,3-dione (PubChem CID 67300541) has the molecular formula C15H9ClN2O4 and a molecular weight of 316.70 g/mol. Its IUPAC name is 2-[(3-chloro-4-nitrophenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-chloro-4-nitrophenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67300541 |
| Molecular Formula | C15H9ClN2O4 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2-[(3-chloro-4-nitrophenyl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C15H9ClN2O4/c16-12-7-9(5-6-13(12)18(21)22)8-17-14(19)10-3-1-2-4-11(10)15(17)20/h1-7H,8H2 |
| InChIKey | PZQBKUMXDSNBRV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|