C23H13ClN2O5 — CID 168517217
2-[[3-chloro-5-(1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 168517217) has the molecular formula C23H13ClN2O5 and a molecular weight of 432.82 g/mol. Its IUPAC name is 2-[[3-chloro-5-(1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-chloro-5-(1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517217 |
| Molecular Formula | C23H13ClN2O5 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-[[3-chloro-5-(1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(Cl)c(O)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H13ClN2O5/c24-17-9-12(11-25-20(28)13-5-1-2-6-14(13)21(25)29)10-18(19(17)27)26-22(30)15-7-3-4-8-16(15)23(26)31/h1-10,27H,11H2 |
| InChIKey | PBESJFUZTNKNIO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|