C20H10ClN5O3 — CID 168607724
2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607724) has the molecular formula C20H10ClN5O3 and a molecular weight of 403.79 g/mol. Its IUPAC name is 2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607724 |
| Molecular Formula | C20H10ClN5O3 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(CN2C(=O)c3ccccc3C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C20H10ClN5O3/c21-15-5-11(6-16(18(15)27)25-17(9-24)12(7-22)8-23)10-26-19(28)13-3-1-2-4-14(13)20(26)29/h1-6,25,27H,10H2 |
| InChIKey | WWKKKJJWVGAWRK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|