C19H11ClN4O3 — CID 168542616
2-[[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]methylidene]propanedinitrile (PubChem CID 168542616) has the molecular formula C19H11ClN4O3 and a molecular weight of 378.78 g/mol. Its IUPAC name is 2-[[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542616 |
| Molecular Formula | C19H11ClN4O3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[[3-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxyanilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(CN2C(=O)c3ccccc3C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C19H11ClN4O3/c20-15-5-11(6-16(17(15)25)23-9-12(7-21)8-22)10-24-18(26)13-3-1-2-4-14(13)19(24)27/h1-6,9,23,25H,10H2 |
| InChIKey | SVDIQUQKHVPBQZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|