C17H10N2O3 — CID 177481598
4-[(1,3,4-trioxoisoquinolin-2-yl)methyl]benzonitrile (PubChem CID 177481598) has the molecular formula C17H10N2O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-[(1,3,4-trioxoisoquinolin-2-yl)methyl]benzonitrile.
| Compound Name | 4-[(1,3,4-trioxoisoquinolin-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 177481598 |
| Molecular Formula | C17H10N2O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[(1,3,4-trioxoisoquinolin-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H10N2O3/c18-9-11-5-7-12(8-6-11)10-19-16(21)14-4-2-1-3-13(14)15(20)17(19)22/h1-8H,10H2 |
| InChIKey | RZXLOGIDPQCWJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|