C18H13N3O3 — CID 2398166
4-[(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl]benzonitrile (PubChem CID 2398166) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 2398166 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-[(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H13N3O3/c19-10-13-6-8-15(9-7-13)12-21-17(23)16(22)20(18(21)24)11-14-4-2-1-3-5-14/h1-9H,11-12H2 |
| InChIKey | AITYFTIQWSLVOR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|