C24H18N4O2 — CID 171781835
4-[(2-benzyl-3,5-dioxo-6-phenyl-1,2,4-triazin-4-yl)methyl]benzonitrile (PubChem CID 171781835) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[(2-benzyl-3,5-dioxo-6-phenyl-1,2,4-triazin-4-yl)methyl]benzonitrile.
| Compound Name | 4-[(2-benzyl-3,5-dioxo-6-phenyl-1,2,4-triazin-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 171781835 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[(2-benzyl-3,5-dioxo-6-phenyl-1,2,4-triazin-4-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2c(=O)c(-c3ccccc3)nn(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C24H18N4O2/c25-15-18-11-13-20(14-12-18)16-27-23(29)22(21-9-5-2-6-10-21)26-28(24(27)30)17-19-7-3-1-4-8-19/h1-14H,16-17H2 |
| InChIKey | URDRJSPQHGYMKV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |