About 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile
4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile (PubChem CID 54442529) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile |
| PubChem CID | 54442529 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2c(-c3ccccc3)c(-c3ccccc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H17N3O/c24-15-17-11-13-18(14-12-17)16-26-22(20-9-5-2-6-10-20)21(25-23(26)27)19-7-3-1-4-8-19/h1-14H,16H2,(H,25,27) |
| InChIKey | WPDAVEZKVHBOPH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile?
The IUPAC name of 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile (CID 54442529) is 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile.
What is the SMILES notation for 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile?
The canonical SMILES for 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile is N#Cc1ccc(Cn2c(-c3ccccc3)c(-c3ccccc3)[nH]c2=O)cc1.
What is the InChIKey of 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile?
The InChIKey is WPDAVEZKVHBOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c24-15-17-11-13-18(14-12-17)16-26-22(20-9-5-2-6-10-20)21(25-23(26)27)19-7-3-1-4-8-19/h1-14H,16H2,(H,25,27).
What are the key properties of 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile?
4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile has a molecular weight of 351.41 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile is sourced from PubChem (CID 54442529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).