C23H17N3O — CID 54442529
4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile (PubChem CID 54442529) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile.
| Compound Name | 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 54442529 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-[(2-oxo-4,5-diphenyl-1H-imidazol-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2c(-c3ccccc3)c(-c3ccccc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H17N3O/c24-15-17-11-13-18(14-12-17)16-26-22(20-9-5-2-6-10-20)21(25-23(26)27)19-7-3-1-4-8-19/h1-14H,16H2,(H,25,27) |
| InChIKey | WPDAVEZKVHBOPH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |