C22H19N5O2 — CID 4878838
4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile (PubChem CID 4878838) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile.
| Compound Name | 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile |
|---|---|
| PubChem CID | 4878838 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile |
| SMILES | CCCn1c(-c2ccc(C#N)cc2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H19N5O2/c1-2-12-26-18-20(24-19(26)17-10-8-15(13-23)9-11-17)27(22(29)25-21(18)28)14-16-6-4-3-5-7-16/h3-11H,2,12,14H2,1H3,(H,25,28,29) |
| InChIKey | TZWWBPRPBZHKJP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |