About 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile
4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile (PubChem CID 4878838) has the molecular formula C22H19N5O2
and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile |
| PubChem CID | 4878838 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile |
| SMILES | CCCn1c(-c2ccc(C#N)cc2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H19N5O2/c1-2-12-26-18-20(24-19(26)17-10-8-15(13-23)9-11-17)27(22(29)25-21(18)28)14-16-6-4-3-5-7-16/h3-11H,2,12,14H2,1H3,(H,25,28,29) |
| InChIKey | TZWWBPRPBZHKJP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile?
The IUPAC name of 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile (CID 4878838) is 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile.
What is the SMILES notation for 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile?
The canonical SMILES for 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile is CCCn1c(-c2ccc(C#N)cc2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1.
What is the InChIKey of 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile?
The InChIKey is TZWWBPRPBZHKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O2/c1-2-12-26-18-20(24-19(26)17-10-8-15(13-23)9-11-17)27(22(29)25-21(18)28)14-16-6-4-3-5-7-16/h3-11H,2,12,14H2,1H3,(H,25,28,29).
What are the key properties of 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile?
4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile has a molecular weight of 385.43 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-benzyl-2,6-dioxo-7-propylpurin-8-yl)benzonitrile is sourced from PubChem (CID 4878838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).