About 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione
7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione (PubChem CID 166350399) has the molecular formula C19H19N5O2S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione.
Molecular Properties
| Compound Name | 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione |
| PubChem CID | 166350399 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cscn1)n2Cc1ccccc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-2-3-9-23-17-15(18(25)22-19(23)26)24(10-13-7-5-4-6-8-13)16(21-17)14-11-27-12-20-14/h4-8,11-12H,2-3,9-10H2,1H3,(H,22,25,26) |
| InChIKey | GPUQYKCXVBBWHK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione?
The IUPAC name of 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione (CID 166350399) is 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione.
What is the SMILES notation for 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione?
The canonical SMILES for 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione is CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cscn1)n2Cc1ccccc1.
What is the InChIKey of 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione?
The InChIKey is GPUQYKCXVBBWHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2S/c1-2-3-9-23-17-15(18(25)22-19(23)26)24(10-13-7-5-4-6-8-13)16(21-17)14-11-27-12-20-14/h4-8,11-12H,2-3,9-10H2,1H3,(H,22,25,26).
What are the key properties of 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione?
7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione has a molecular weight of 381.46 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-3-butyl-8-(1,3-thiazol-4-yl)purine-2,6-dione is sourced from PubChem (CID 166350399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).