C18H18N4O3S — CID 5158545
3-butyl-7-(furan-2-ylmethyl)-8-thiophen-2-ylpurine-2,6-dione (PubChem CID 5158545) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-butyl-7-(furan-2-ylmethyl)-8-thiophen-2-ylpurine-2,6-dione.
| Compound Name | 3-butyl-7-(furan-2-ylmethyl)-8-thiophen-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 5158545 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-butyl-7-(furan-2-ylmethyl)-8-thiophen-2-ylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cccs1)n2Cc1ccco1 |
| InChI | InChI=1S/C18H18N4O3S/c1-2-3-8-21-16-14(17(23)20-18(21)24)22(11-12-6-4-9-25-12)15(19-16)13-7-5-10-26-13/h4-7,9-10H,2-3,8,11H2,1H3,(H,20,23,24) |
| InChIKey | PASRSNNLKXQAJH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |