C21H18BrFN4O3 — CID 3549128
7-benzyl-8-(5-bromo-2-fluorophenyl)-3-(2-methoxyethyl)purine-2,6-dione (PubChem CID 3549128) has the molecular formula C21H18BrFN4O3 and a molecular weight of 473.30 g/mol. Its IUPAC name is 7-benzyl-8-(5-bromo-2-fluorophenyl)-3-(2-methoxyethyl)purine-2,6-dione.
| Compound Name | 7-benzyl-8-(5-bromo-2-fluorophenyl)-3-(2-methoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3549128 |
| Molecular Formula | C21H18BrFN4O3 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 7-benzyl-8-(5-bromo-2-fluorophenyl)-3-(2-methoxyethyl)purine-2,6-dione |
| SMILES | COCCn1c(=O)[nH]c(=O)c2c1nc(-c1cc(Br)ccc1F)n2Cc1ccccc1 |
| InChI | InChI=1S/C21H18BrFN4O3/c1-30-10-9-26-19-17(20(28)25-21(26)29)27(12-13-5-3-2-4-6-13)18(24-19)15-11-14(22)7-8-16(15)23/h2-8,11H,9-10,12H2,1H3,(H,25,28,29) |
| InChIKey | MYLWWEHFLZMYEF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |