C20H17BrN4O4 — CID 2998299
3-benzyl-8-(5-bromo-2-hydroxy-3-methoxyphenyl)-7-methylpurine-2,6-dione (PubChem CID 2998299) has the molecular formula C20H17BrN4O4 and a molecular weight of 457.28 g/mol. Its IUPAC name is 3-benzyl-8-(5-bromo-2-hydroxy-3-methoxyphenyl)-7-methylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-(5-bromo-2-hydroxy-3-methoxyphenyl)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 2998299 |
| Molecular Formula | C20H17BrN4O4 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 3-benzyl-8-(5-bromo-2-hydroxy-3-methoxyphenyl)-7-methylpurine-2,6-dione |
| SMILES | COc1cc(Br)cc(-c2nc3c(c(=O)[nH]c(=O)n3Cc3ccccc3)n2C)c1O |
| InChI | InChI=1S/C20H17BrN4O4/c1-24-15-18(22-17(24)13-8-12(21)9-14(29-2)16(13)26)25(20(28)23-19(15)27)10-11-6-4-3-5-7-11/h3-9,26H,10H2,1-2H3,(H,23,27,28) |
| InChIKey | BICIXNVWZLMAKH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |