C24H24ClN5O4 — CID 24598927
2-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methoxy]-5-chlorobenzamide (PubChem CID 24598927) has the molecular formula C24H24ClN5O4 and a molecular weight of 481.94 g/mol. Its IUPAC name is 2-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methoxy]-5-chlorobenzamide.
| Compound Name | 2-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methoxy]-5-chlorobenzamide |
|---|---|
| PubChem CID | 24598927 |
| Molecular Formula | C24H24ClN5O4 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-[(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methoxy]-5-chlorobenzamide |
| SMILES | CCCCn1c(COc2ccc(Cl)cc2C(N)=O)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClN5O4/c1-2-3-11-29-19(14-34-18-10-9-16(25)12-17(18)21(26)31)27-22-20(29)23(32)28-24(33)30(22)13-15-7-5-4-6-8-15/h4-10,12H,2-3,11,13-14H2,1H3,(H2,26,31)(H,28,32,33) |
| InChIKey | IBLQSBJYOGPNMH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |