C25H31N5O5 — CID 42925645
(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl 1-acetylpiperidine-3-carboxylate (PubChem CID 42925645) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl 1-acetylpiperidine-3-carboxylate.
| Compound Name | (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl 1-acetylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 42925645 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl 1-acetylpiperidine-3-carboxylate |
| SMILES | CCCCn1c(COC(=O)C2CCCN(C(C)=O)C2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H31N5O5/c1-3-4-13-29-20(16-35-24(33)19-11-8-12-28(15-19)17(2)31)26-22-21(29)23(32)27-25(34)30(22)14-18-9-6-5-7-10-18/h5-7,9-10,19H,3-4,8,11-16H2,1-2H3,(H,27,32,34) |
| InChIKey | CTSNSHPRKKPNNT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |