C19H27N5O5 — CID 86816248
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 1-methyl-2-oxopyrrolidine-3-carboxylate (PubChem CID 86816248) has the molecular formula C19H27N5O5 and a molecular weight of 405.46 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 1-methyl-2-oxopyrrolidine-3-carboxylate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 1-methyl-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 86816248 |
| Molecular Formula | C19H27N5O5 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 1-methyl-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1CCN(C)C1=O)n2CCC |
| InChI | InChI=1S/C19H27N5O5/c1-4-6-9-24-15-14(16(25)21-19(24)28)23(8-5-2)13(20-15)11-29-18(27)12-7-10-22(3)17(12)26/h12H,4-11H2,1-3H3,(H,21,25,28) |
| InChIKey | MGIXAYYCJAIHTA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|