C24H34N4O4 — CID 60534751
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl adamantane-2-carboxylate (PubChem CID 60534751) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl adamantane-2-carboxylate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl adamantane-2-carboxylate |
|---|---|
| PubChem CID | 60534751 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl adamantane-2-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1C3CC4CC(C3)CC1C4)n2CCC |
| InChI | InChI=1S/C24H34N4O4/c1-3-5-7-28-21-20(22(29)26-24(28)31)27(6-4-2)18(25-21)13-32-23(30)19-16-9-14-8-15(11-16)12-17(19)10-14/h14-17,19H,3-13H2,1-2H3,(H,26,29,31) |
| InChIKey | ZTYQZIDMIRHAMH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |