About (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate (PubChem CID 75468132) has the molecular formula C20H28N4O5
and a molecular weight of 404.47 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate |
| PubChem CID | 75468132 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1CCC(=O)CC1)n2CCC |
| InChI | InChI=1S/C20H28N4O5/c1-3-5-11-24-17-16(18(26)22-20(24)28)23(10-4-2)15(21-17)12-29-19(27)13-6-8-14(25)9-7-13/h13H,3-12H2,1-2H3,(H,22,26,28) |
| InChIKey | YDJBRNPWUPQKPF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate?
The IUPAC name of (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate (CID 75468132) is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate.
What is the SMILES notation for (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate?
The canonical SMILES for (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate is CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1CCC(=O)CC1)n2CCC.
What is the InChIKey of (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate?
The InChIKey is YDJBRNPWUPQKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O5/c1-3-5-11-24-17-16(18(26)22-20(24)28)23(10-4-2)15(21-17)12-29-19(27)13-6-8-14(25)9-7-13/h13H,3-12H2,1-2H3,(H,22,26,28).
What are the key properties of (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate?
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate has a molecular weight of 404.47 g/mol, XLogP of 1.90, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 4-oxocyclohexane-1-carboxylate is sourced from PubChem (CID 75468132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).