C24H34N4O5 — CID 98301756
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 98301756) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98301756 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (5R,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C13C[C@H]4C[C@@H](CC(O)(C4)C1)C3)n2CCC |
| InChI | InChI=1S/C24H34N4O5/c1-3-5-7-28-19-18(20(29)26-22(28)31)27(6-4-2)17(25-19)13-33-21(30)23-9-15-8-16(10-23)12-24(32,11-15)14-23/h15-16,32H,3-14H2,1-2H3,(H,26,29,31)/t15-,16-,23?,24?/m1/s1 |
| InChIKey | YQIREGHEMRHOQT-FNZWZJOASA-N |
| XLogP | 2.47 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |