About (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate (PubChem CID 55403632) has the molecular formula C22H27N5O6
and a molecular weight of 457.49 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 55403632 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1CCN(C(=O)c3ccco3)CC1)n2C |
| InChI | InChI=1S/C22H27N5O6/c1-3-4-9-27-18-17(19(28)24-22(27)31)25(2)16(23-18)13-33-21(30)14-7-10-26(11-8-14)20(29)15-6-5-12-32-15/h5-6,12,14H,3-4,7-11,13H2,1-2H3,(H,24,28,31) |
| InChIKey | JVDGIOZJLDPGGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate?
The IUPAC name of (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate (CID 55403632) is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate is CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)C1CCN(C(=O)c3ccco3)CC1)n2C.
What is the InChIKey of (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate?
The InChIKey is JVDGIOZJLDPGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O6/c1-3-4-9-27-18-17(19(28)24-22(27)31)25(2)16(23-18)13-33-21(30)14-7-10-26(11-8-14)20(29)15-6-5-12-32-15/h5-6,12,14H,3-4,7-11,13H2,1-2H3,(H,24,28,31).
What are the key properties of (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate?
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate has a molecular weight of 457.49 g/mol, XLogP of 1.41, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 1-(furan-2-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 55403632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).