C29H26ClN5O4 — CID 139517188
N-benzyl-3-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methoxy]benzamide (PubChem CID 139517188) has the molecular formula C29H26ClN5O4 and a molecular weight of 544.01 g/mol. Its IUPAC name is N-benzyl-3-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methoxy]benzamide.
| Compound Name | N-benzyl-3-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 139517188 |
| Molecular Formula | C29H26ClN5O4 |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | N-benzyl-3-[[3-[(4-chlorophenyl)methyl]-7-ethyl-2,6-dioxopurin-8-yl]methoxy]benzamide |
| SMILES | CCn1c(COc2cccc(C(=O)NCc3ccccc3)c2)nc2c1c(=O)[nH]c(=O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H26ClN5O4/c1-2-34-24(18-39-23-10-6-9-21(15-23)27(36)31-16-19-7-4-3-5-8-19)32-26-25(34)28(37)33-29(38)35(26)17-20-11-13-22(30)14-12-20/h3-15H,2,16-18H2,1H3,(H,31,36)(H,33,37,38) |
| InChIKey | SNOURKATQKOBEP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |