C22H29N5O2S2 — CID 24557400
(3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 24557400) has the molecular formula C22H29N5O2S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 24557400 |
| Molecular Formula | C22H29N5O2S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (3-benzyl-7-butyl-2,6-dioxopurin-8-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCCCn1c(CSC(=S)N(CC)CC)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H29N5O2S2/c1-4-7-13-26-17(15-31-22(30)25(5-2)6-3)23-19-18(26)20(28)24-21(29)27(19)14-16-11-9-8-10-12-16/h8-12H,4-7,13-15H2,1-3H3,(H,24,28,29) |
| InChIKey | QWNWBARQWXXICY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|