C25H25ClN4O5 — CID 25352472
3-benzyl-8-(3-chloro-4,5-dimethoxyphenyl)-7-[[(2R)-oxolan-2-yl]methyl]purine-2,6-dione (PubChem CID 25352472) has the molecular formula C25H25ClN4O5 and a molecular weight of 496.95 g/mol. Its IUPAC name is 3-benzyl-8-(3-chloro-4,5-dimethoxyphenyl)-7-[[(2R)-oxolan-2-yl]methyl]purine-2,6-dione.
| Compound Name | 3-benzyl-8-(3-chloro-4,5-dimethoxyphenyl)-7-[[(2R)-oxolan-2-yl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 25352472 |
| Molecular Formula | C25H25ClN4O5 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-benzyl-8-(3-chloro-4,5-dimethoxyphenyl)-7-[[(2R)-oxolan-2-yl]methyl]purine-2,6-dione |
| SMILES | COc1cc(-c2nc3c(c(=O)[nH]c(=O)n3Cc3ccccc3)n2C[C@H]2CCCO2)cc(Cl)c1OC |
| InChI | InChI=1S/C25H25ClN4O5/c1-33-19-12-16(11-18(26)21(19)34-2)22-27-23-20(29(22)14-17-9-6-10-35-17)24(31)28-25(32)30(23)13-15-7-4-3-5-8-15/h3-5,7-8,11-12,17H,6,9-10,13-14H2,1-2H3,(H,28,31,32)/t17-/m1/s1 |
| InChIKey | ZGZXSWXNVWBQHJ-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |