C11H9N3O2 — CID 91543065
4-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]benzonitrile (PubChem CID 91543065) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]benzonitrile.
| Compound Name | 4-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 91543065 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 4-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2c(O)c[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H9N3O2/c12-5-8-1-3-9(4-2-8)7-14-10(15)6-13-11(14)16/h1-4,6,15H,7H2,(H,13,16) |
| InChIKey | JRQLJGLDLJUIJH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |