C22H16ClN3OS — CID 134095455
2-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanylidene-1,2,4-triazin-5-one (PubChem CID 134095455) has the molecular formula C22H16ClN3OS and a molecular weight of 405.91 g/mol. Its IUPAC name is 2-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanylidene-1,2,4-triazin-5-one.
| Compound Name | 2-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanylidene-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134095455 |
| Molecular Formula | C22H16ClN3OS |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanylidene-1,2,4-triazin-5-one |
| SMILES | O=c1c(-c2ccccc2)nn(Cc2ccccc2)c(=S)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN3OS/c23-18-11-13-19(14-12-18)26-21(27)20(17-9-5-2-6-10-17)24-25(22(26)28)15-16-7-3-1-4-8-16/h1-14H,15H2 |
| InChIKey | ODWHFIRIIPSBFF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|