C20H14ClN3S — CID 10761239
2-(4-chlorophenyl)-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 10761239) has the molecular formula C20H14ClN3S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,5-diphenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-(4-chlorophenyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10761239 |
| Molecular Formula | C20H14ClN3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(4-chlorophenyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(-c2ccc(Cl)cc2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H14ClN3S/c21-16-11-13-18(14-12-16)24-20(25)23(17-9-5-2-6-10-17)19(22-24)15-7-3-1-4-8-15/h1-14H |
| InChIKey | HBCCWVWDYMIGJP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|