C15H12ClN3O — CID 115395824
[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanol (PubChem CID 115395824) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115395824 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H12ClN3O/c16-12-8-6-11(7-9-12)15-18-17-14(10-20)19(15)13-4-2-1-3-5-13/h1-9,20H,10H2 |
| InChIKey | LVMZCPATJDFNFO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |