C22H18ClN3Se — CID 24764379
4-(4-chlorophenyl)-3-phenyl-5-(2-phenylselanylethyl)-1,2,4-triazole (PubChem CID 24764379) has the molecular formula C22H18ClN3Se and a molecular weight of 438.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-phenyl-5-(2-phenylselanylethyl)-1,2,4-triazole.
| Compound Name | 4-(4-chlorophenyl)-3-phenyl-5-(2-phenylselanylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 24764379 |
| Molecular Formula | C22H18ClN3Se |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-(4-chlorophenyl)-3-phenyl-5-(2-phenylselanylethyl)-1,2,4-triazole |
| SMILES | Clc1ccc(-n2c(CC[Se]c3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClN3Se/c23-18-11-13-19(14-12-18)26-21(15-16-27-20-9-5-2-6-10-20)24-25-22(26)17-7-3-1-4-8-17/h1-14H,15-16H2 |
| InChIKey | ZOJMVBOSBMFSEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|