C15H10BrCl2N3 — CID 115398710
3-(bromomethyl)-5-(3,4-dichlorophenyl)-4-phenyl-1,2,4-triazole (PubChem CID 115398710) has the molecular formula C15H10BrCl2N3 and a molecular weight of 383.08 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(3,4-dichlorophenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(3,4-dichlorophenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115398710 |
| Molecular Formula | C15H10BrCl2N3 |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 3-(bromomethyl)-5-(3,4-dichlorophenyl)-4-phenyl-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nnc(CBr)n2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H10BrCl2N3/c16-9-14-19-20-15(10-6-7-12(17)13(18)8-10)21(14)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | IMTFFMCXORGPOJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|