C16H11BrN4 — CID 115398767
3-[5-(bromomethyl)-4-phenyl-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 115398767) has the molecular formula C16H11BrN4 and a molecular weight of 339.20 g/mol. Its IUPAC name is 3-[5-(bromomethyl)-4-phenyl-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 3-[5-(bromomethyl)-4-phenyl-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 115398767 |
| Molecular Formula | C16H11BrN4 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 3-[5-(bromomethyl)-4-phenyl-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nnc(CBr)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C16H11BrN4/c17-10-15-19-20-16(13-6-4-5-12(9-13)11-18)21(15)14-7-2-1-3-8-14/h1-9H,10H2 |
| InChIKey | LKEAROMDMYMWSV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|