C15H13FN4 — CID 115943885
[5-(3-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 115943885) has the molecular formula C15H13FN4 and a molecular weight of 268.30 g/mol. Its IUPAC name is [5-(3-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-(3-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 115943885 |
| Molecular Formula | C15H13FN4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [5-(3-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1nnc(-c2cccc(F)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H13FN4/c16-12-6-4-5-11(9-12)15-19-18-14(10-17)20(15)13-7-2-1-3-8-13/h1-9H,10,17H2 |
| InChIKey | VSCYVXWSNIMGLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |