C20H13I2N3 — CID 153407189
3,5-bis(3-iodophenyl)-4-phenyl-1,2,4-triazole (PubChem CID 153407189) has the molecular formula C20H13I2N3 and a molecular weight of 549.15 g/mol. Its IUPAC name is 3,5-bis(3-iodophenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3,5-bis(3-iodophenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 153407189 |
| Molecular Formula | C20H13I2N3 |
| Molecular Weight | 549.15 g/mol |
| Exact Mass | 548.92 |
| IUPAC Name | 3,5-bis(3-iodophenyl)-4-phenyl-1,2,4-triazole |
| SMILES | Ic1cccc(-c2nnc(-c3cccc(I)c3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H13I2N3/c21-16-8-4-6-14(12-16)19-23-24-20(15-7-5-9-17(22)13-15)25(19)18-10-2-1-3-11-18/h1-13H |
| InChIKey | WMWSJBSQPQEGAQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.15 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|