C66H70IN3 — CID 101412676
3-(4-tert-butylphenyl)-5-[3-[9,9-dibutyl-7-(9,9-dibutyl-7-iodofluoren-2-yl)fluoren-2-yl]phenyl]-4-phenyl-1,2,4-triazole (PubChem CID 101412676) has the molecular formula C66H70IN3 and a molecular weight of 1032.21 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-[3-[9,9-dibutyl-7-(9,9-dibutyl-7-iodofluoren-2-yl)fluoren-2-yl]phenyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(4-tert-butylphenyl)-5-[3-[9,9-dibutyl-7-(9,9-dibutyl-7-iodofluoren-2-yl)fluoren-2-yl]phenyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 101412676 |
| Molecular Formula | C66H70IN3 |
| Molecular Weight | 1032.21 g/mol |
| Exact Mass | 1031.46 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-[3-[9,9-dibutyl-7-(9,9-dibutyl-7-iodofluoren-2-yl)fluoren-2-yl]phenyl]-4-phenyl-1,2,4-triazole |
| SMILES | CCCCC1(CCCC)c2cc(I)ccc2-c2ccc(-c3ccc4c(c3)C(CCCC)(CCCC)c3cc(-c5cccc(-c6nnc(-c7ccc(C(C)(C)C)cc7)n6-c6ccccc6)c5)ccc3-4)cc21 |
| InChI | InChI=1S/C66H70IN3/c1-8-12-36-65(37-13-9-2)58-41-47(46-20-19-21-50(40-46)63-69-68-62(70(63)53-22-17-16-18-23-53)45-24-29-51(30-25-45)64(5,6)7)26-32-54(58)55-33-27-48(42-59(55)65)49-28-34-56-57-35-31-52(67)44-61(57)66(38-14-10-3,39-15-11-4)60(56)43-49/h16-35,40-44H,8-15,36-39H2,1-7H3 |
| InChIKey | LGBOEZURJHUZMZ-UHFFFAOYSA-N |
| XLogP | 19.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.21 |
| LogP ≤ 5 | 19.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|