C80H89N3O — CID 102451900
2-(4-tert-butylphenyl)-5-[4-[7-(7-carbazol-9-yl-9,9-dihexylfluoren-2-yl)-9,9-dihexylfluoren-2-yl]phenyl]-1,3,4-oxadiazole (PubChem CID 102451900) has the molecular formula C80H89N3O and a molecular weight of 1108.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-[4-[7-(7-carbazol-9-yl-9,9-dihexylfluoren-2-yl)-9,9-dihexylfluoren-2-yl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-tert-butylphenyl)-5-[4-[7-(7-carbazol-9-yl-9,9-dihexylfluoren-2-yl)-9,9-dihexylfluoren-2-yl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102451900 |
| Molecular Formula | C80H89N3O |
| Molecular Weight | 1108.61 g/mol |
| Exact Mass | 1107.70 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-[4-[7-(7-carbazol-9-yl-9,9-dihexylfluoren-2-yl)-9,9-dihexylfluoren-2-yl]phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ccc(-c4nnc(-c5ccc(C(C)(C)C)cc5)o4)cc3)ccc2-c2ccc(-c3ccc4c(c3)C(CCCCCC)(CCCCCC)c3cc(-n5c6ccccc6c6ccccc65)ccc3-4)cc21 |
| InChI | InChI=1S/C80H89N3O/c1-8-12-16-24-48-79(49-25-17-13-9-2)70-52-59(56-32-34-57(35-33-56)76-81-82-77(84-76)58-36-41-62(42-37-58)78(5,6)7)38-44-64(70)65-45-39-60(53-71(65)79)61-40-46-66-67-47-43-63(83-74-30-22-20-28-68(74)69-29-21-23-31-75(69)83)55-73(67)80(72(66)54-61,50-26-18-14-10-3)51-27-19-15-11-4/h20-23,28-47,52-55H,8-19,24-27,48-51H2,1-7H3 |
| InChIKey | ONCJLRUNSZTIFH-UHFFFAOYSA-N |
| XLogP | 23.55 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.61 |
| LogP ≤ 5 | 23.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|