C47H59N3O — CID 154638202
2-(4-tert-butylphenyl)-5-[4-(9,9-dioctylacridin-10-yl)phenyl]-1,3,4-oxadiazole (PubChem CID 154638202) has the molecular formula C47H59N3O and a molecular weight of 682.01 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-[4-(9,9-dioctylacridin-10-yl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-tert-butylphenyl)-5-[4-(9,9-dioctylacridin-10-yl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 154638202 |
| Molecular Formula | C47H59N3O |
| Molecular Weight | 682.01 g/mol |
| Exact Mass | 681.47 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-[4-(9,9-dioctylacridin-10-yl)phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2N(c2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)c2ccccc21 |
| InChI | InChI=1S/C47H59N3O/c1-6-8-10-12-14-20-34-47(35-21-15-13-11-9-7-2)40-22-16-18-24-42(40)50(43-25-19-17-23-41(43)47)39-32-28-37(29-33-39)45-49-48-44(51-45)36-26-30-38(31-27-36)46(3,4)5/h16-19,22-33H,6-15,20-21,34-35H2,1-5H3 |
| InChIKey | RKAOMAOOEYPISD-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.01 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|