C59H81B2N3O5 — CID 168854049
2-(4-tert-butylphenyl)-5-[4-[9,9-dioctyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-10-yl]phenyl]-1,3,4-oxadiazole (PubChem CID 168854049) has the molecular formula C59H81B2N3O5 and a molecular weight of 933.94 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-[4-[9,9-dioctyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-10-yl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-tert-butylphenyl)-5-[4-[9,9-dioctyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-10-yl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 168854049 |
| Molecular Formula | C59H81B2N3O5 |
| Molecular Weight | 933.94 g/mol |
| Exact Mass | 933.64 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-[4-[9,9-dioctyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acridin-10-yl]phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2N(c2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C59H81B2N3O5/c1-14-16-18-20-22-24-38-59(39-25-23-21-19-17-15-2)48-40-45(60-66-55(6,7)56(8,9)67-60)32-36-50(48)64(51-37-33-46(41-49(51)59)61-68-57(10,11)58(12,13)69-61)47-34-28-43(29-35-47)53-63-62-52(65-53)42-26-30-44(31-27-42)54(3,4)5/h26-37,40-41H,14-25,38-39H2,1-13H3 |
| InChIKey | SSMUFRALEGUZPS-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 79.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.94 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|