C27H38BNO2 — CID 163733041
3-hexyl-3-methyl-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indole (PubChem CID 163733041) has the molecular formula C27H38BNO2 and a molecular weight of 419.42 g/mol. Its IUPAC name is 3-hexyl-3-methyl-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indole.
| Compound Name | 3-hexyl-3-methyl-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indole |
|---|---|
| PubChem CID | 163733041 |
| Molecular Formula | C27H38BNO2 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 3-hexyl-3-methyl-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indole |
| SMILES | CCCCCCC1(C)CN(c2ccccc2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C27H38BNO2/c1-7-8-9-13-18-27(6)20-29(22-14-11-10-12-15-22)24-17-16-21(19-23(24)27)28-30-25(2,3)26(4,5)31-28/h10-12,14-17,19H,7-9,13,18,20H2,1-6H3 |
| InChIKey | LBGAYHGLRQTGPT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|