C28H49BO4 — CID 58879562
2-(3,4-dioctoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 58879562) has the molecular formula C28H49BO4 and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-(3,4-dioctoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,4-dioctoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58879562 |
| Molecular Formula | C28H49BO4 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | 2-(3,4-dioctoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OCCCCCCCC |
| InChI | InChI=1S/C28H49BO4/c1-7-9-11-13-15-17-21-30-25-20-19-24(29-32-27(3,4)28(5,6)33-29)23-26(25)31-22-18-16-14-12-10-8-2/h19-20,23H,7-18,21-22H2,1-6H3 |
| InChIKey | RYTNGDUFGBKEAB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|