C40H52B2O6 — CID 160905440
2-[6-butoxy-5-[2-butoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 160905440) has the molecular formula C40H52B2O6 and a molecular weight of 650.47 g/mol. Its IUPAC name is 2-[6-butoxy-5-[2-butoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-butoxy-5-[2-butoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 160905440 |
| Molecular Formula | C40H52B2O6 |
| Molecular Weight | 650.47 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | 2-[6-butoxy-5-[2-butoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCOc1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1-c1c(OCCCC)ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C40H52B2O6/c1-11-13-23-43-33-21-15-27-25-29(41-45-37(3,4)38(5,6)46-41)17-19-31(27)35(33)36-32-20-18-30(42-47-39(7,8)40(9,10)48-42)26-28(32)16-22-34(36)44-24-14-12-2/h15-22,25-26H,11-14,23-24H2,1-10H3 |
| InChIKey | YGBGXEPMJPOPLV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.47 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|