C16H18B2O2 — CID 88941720
CID 88941720 (PubChem CID 88941720) has the molecular formula C16H18B2O2 and a molecular weight of 263.94 g/mol.
| Compound Name | CID 88941720 |
|---|---|
| PubChem CID | 88941720 |
| Molecular Formula | C16H18B2O2 |
| Molecular Weight | 263.94 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1 |
| InChI | InChI=1S/C16H18B2O2/c1-15(2)16(3,4)20-18(19-15)14-8-6-11-9-13(17)7-5-12(11)10-14/h5-10H,1-4H3 |
| InChIKey | WFESLLQKRONAPG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.94 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|