C34H54B2O6 — CID 58789473
2-[1,5-dihexoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 58789473) has the molecular formula C34H54B2O6 and a molecular weight of 580.42 g/mol. Its IUPAC name is 2-[1,5-dihexoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1,5-dihexoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58789473 |
| Molecular Formula | C34H54B2O6 |
| Molecular Weight | 580.42 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | 2-[1,5-dihexoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCOc1c(B2OC(C)(C)C(C)(C)O2)ccc2c(OCCCCCC)c(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C34H54B2O6/c1-11-13-15-17-23-37-29-25-19-22-28(36-41-33(7,8)34(9,10)42-36)30(38-24-18-16-14-12-2)26(25)20-21-27(29)35-39-31(3,4)32(5,6)40-35/h19-22H,11-18,23-24H2,1-10H3 |
| InChIKey | IPFNESWJWDUIPO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.42 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|