C16H26BNO3 — CID 79662779
3-pentoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 79662779) has the molecular formula C16H26BNO3 and a molecular weight of 291.20 g/mol. Its IUPAC name is 3-pentoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-pentoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 79662779 |
| Molecular Formula | C16H26BNO3 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-pentoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCCCCOc1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H26BNO3/c1-6-7-8-9-19-14-10-13(11-18-12-14)17-20-15(2,3)16(4,5)21-17/h10-12H,6-9H2,1-5H3 |
| InChIKey | QRIHQMIOCNRYLV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|