C19H21BF3NO3 — CID 177245514
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[[3-(trifluoromethyl)phenyl]methoxy]pyridine (PubChem CID 177245514) has the molecular formula C19H21BF3NO3 and a molecular weight of 379.19 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[[3-(trifluoromethyl)phenyl]methoxy]pyridine.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[[3-(trifluoromethyl)phenyl]methoxy]pyridine |
|---|---|
| PubChem CID | 177245514 |
| Molecular Formula | C19H21BF3NO3 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[[3-(trifluoromethyl)phenyl]methoxy]pyridine |
| SMILES | CC1(C)OB(c2cncc(OCc3cccc(C(F)(F)F)c3)c2)OC1(C)C |
| InChI | InChI=1S/C19H21BF3NO3/c1-17(2)18(3,4)27-20(26-17)15-9-16(11-24-10-15)25-12-13-6-5-7-14(8-13)19(21,22)23/h5-11H,12H2,1-4H3 |
| InChIKey | PEXRFLWTOWSGRO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|