C26H26BF3O3 — CID 140810430
4,4,5,5-tetramethyl-2-[2-phenylmethoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 140810430) has the molecular formula C26H26BF3O3 and a molecular weight of 454.30 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-phenylmethoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-phenylmethoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140810430 |
| Molecular Formula | C26H26BF3O3 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-phenylmethoxy-5-[3-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(-c3cccc(C(F)(F)F)c3)ccc2OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H26BF3O3/c1-24(2)25(3,4)33-27(32-24)22-16-20(19-11-8-12-21(15-19)26(28,29)30)13-14-23(22)31-17-18-9-6-5-7-10-18/h5-16H,17H2,1-4H3 |
| InChIKey | SCJIYBUKUUSYNK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|